C9H13F8NO — CID 20725498
N-(2-ethoxy-1,1,2,2-tetrafluoroethyl)-N,1,1,5-tetrafluoropentan-1-amine (PubChem CID 20725498) has the molecular formula C9H13F8NO and a molecular weight of 303.19 g/mol. Its IUPAC name is N-(2-ethoxy-1,1,2,2-tetrafluoroethyl)-N,1,1,5-tetrafluoropentan-1-amine.
| Compound Name | N-(2-ethoxy-1,1,2,2-tetrafluoroethyl)-N,1,1,5-tetrafluoropentan-1-amine |
|---|---|
| PubChem CID | 20725498 |
| Molecular Formula | C9H13F8NO |
| Molecular Weight | 303.19 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | N-(2-ethoxy-1,1,2,2-tetrafluoroethyl)-N,1,1,5-tetrafluoropentan-1-amine |
| SMILES | CCOC(F)(F)C(F)(F)N(F)C(F)(F)CCCCF |
| InChI | InChI=1S/C9H13F8NO/c1-2-19-9(15,16)8(13,14)18(17)7(11,12)5-3-4-6-10/h2-6H2,1H3 |
| InChIKey | PTGRUNJNYNXAGS-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.19 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|