C35H42N2O7 — CID 20725894
(1-phenyl-7-pyridin-3-ylheptan-4-yl) 1-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]piperidine-2-carboxylate (PubChem CID 20725894) has the molecular formula C35H42N2O7 and a molecular weight of 602.73 g/mol. Its IUPAC name is (1-phenyl-7-pyridin-3-ylheptan-4-yl) 1-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]piperidine-2-carboxylate.
| Compound Name | (1-phenyl-7-pyridin-3-ylheptan-4-yl) 1-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 20725894 |
| Molecular Formula | C35H42N2O7 |
| Molecular Weight | 602.73 g/mol |
| Exact Mass | 602.30 |
| IUPAC Name | (1-phenyl-7-pyridin-3-ylheptan-4-yl) 1-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]piperidine-2-carboxylate |
| SMILES | COc1cc(C(=O)C(=O)N2CCCCC2C(=O)OC(CCCc2ccccc2)CCCc2cccnc2)cc(OC)c1OC |
| InChI | InChI=1S/C35H42N2O7/c1-41-30-22-27(23-31(42-2)33(30)43-3)32(38)34(39)37-21-8-7-19-29(37)35(40)44-28(17-9-14-25-12-5-4-6-13-25)18-10-15-26-16-11-20-36-24-26/h4-6,11-13,16,20,22-24,28-29H,7-10,14-15,17-19,21H2,1-3H3 |
| InChIKey | FPYPCCMYCGEALM-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 104.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.73 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|