C11H14Br2O2S — CID 20726171
3,3-bis(bromomethyl)-6,8-dimethyl-2,4-dihydrothieno[3,4-b][1,4]dioxepine (PubChem CID 20726171) has the molecular formula C11H14Br2O2S and a molecular weight of 370.11 g/mol. Its IUPAC name is 3,3-bis(bromomethyl)-6,8-dimethyl-2,4-dihydrothieno[3,4-b][1,4]dioxepine.
| Compound Name | 3,3-bis(bromomethyl)-6,8-dimethyl-2,4-dihydrothieno[3,4-b][1,4]dioxepine |
|---|---|
| PubChem CID | 20726171 |
| Molecular Formula | C11H14Br2O2S |
| Molecular Weight | 370.11 g/mol |
| Exact Mass | 367.91 |
| IUPAC Name | 3,3-bis(bromomethyl)-6,8-dimethyl-2,4-dihydrothieno[3,4-b][1,4]dioxepine |
| SMILES | Cc1sc(C)c2c1OCC(CBr)(CBr)CO2 |
| InChI | InChI=1S/C11H14Br2O2S/c1-7-9-10(8(2)16-7)15-6-11(3-12,4-13)5-14-9/h3-6H2,1-2H3 |
| InChIKey | IGAVXAYOASVBJL-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.11 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|