C15H25F3OSi — CID 20726306
4-cyclohexyloxybut-1-ynyl-dimethyl-(3,3,3-trifluoropropyl)silane (PubChem CID 20726306) has the molecular formula C15H25F3OSi and a molecular weight of 306.44 g/mol. Its IUPAC name is 4-cyclohexyloxybut-1-ynyl-dimethyl-(3,3,3-trifluoropropyl)silane.
| Compound Name | 4-cyclohexyloxybut-1-ynyl-dimethyl-(3,3,3-trifluoropropyl)silane |
|---|---|
| PubChem CID | 20726306 |
| Molecular Formula | C15H25F3OSi |
| Molecular Weight | 306.44 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 4-cyclohexyloxybut-1-ynyl-dimethyl-(3,3,3-trifluoropropyl)silane |
| SMILES | C[Si](C)(C#CCCOC1CCCCC1)CCC(F)(F)F |
| InChI | InChI=1S/C15H25F3OSi/c1-20(2,13-10-15(16,17)18)12-7-6-11-19-14-8-4-3-5-9-14/h14H,3-6,8-11,13H2,1-2H3 |
| InChIKey | HUXALZFBCSXQLD-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.44 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|