C19H18N4O7S — CID 2072642
2-(3-methyl-4-nitrophenoxy)-N-[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]acetamide (PubChem CID 2072642) has the molecular formula C19H18N4O7S and a molecular weight of 446.44 g/mol. Its IUPAC name is 2-(3-methyl-4-nitrophenoxy)-N-[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]acetamide.
| Compound Name | 2-(3-methyl-4-nitrophenoxy)-N-[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 2072642 |
| Molecular Formula | C19H18N4O7S |
| Molecular Weight | 446.44 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | 2-(3-methyl-4-nitrophenoxy)-N-[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]acetamide |
| SMILES | Cc1cc(NS(=O)(=O)c2ccc(NC(=O)COc3ccc([N+](=O)[O-])c(C)c3)cc2)no1 |
| InChI | InChI=1S/C19H18N4O7S/c1-12-9-15(5-8-17(12)23(25)26)29-11-19(24)20-14-3-6-16(7-4-14)31(27,28)22-18-10-13(2)30-21-18/h3-10H,11H2,1-2H3,(H,20,24)(H,21,22) |
| InChIKey | ORKOSALHKOKYDC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 153.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|