[(3E)-hexa-3,5-dienyl] methyl hydrogen phosphate

C7H13O4P — CID 20726645

IUPAC[(3E)-hexa-3,5-dienyl] methyl hydrogen phosphate
SMILESC=C/C=C/CCOP(=O)(O)OC
InChIInChI=1S/C7H13O4P/c1-3-4-5-6-7-11-12(8,9)10-2/h3-5H,1,6-7H2,2H3,(H,8,9)/b5-4+
InChIKeyYGWYJUWRDQXPBU-SNAWJCMRSA-N
MW192.15 g/mol
LogP1.88
Rot. Bonds6

About [(3E)-hexa-3,5-dienyl] methyl hydrogen phosphate

[(3E)-hexa-3,5-dienyl] methyl hydrogen phosphate (PubChem CID 20726645) has the molecular formula C7H13O4P and a molecular weight of 192.15 g/mol. Its IUPAC name is [(3E)-hexa-3,5-dienyl] methyl hydrogen phosphate.

Molecular Properties

Compound Name[(3E)-hexa-3,5-dienyl] methyl hydrogen phosphate
PubChem CID20726645
Molecular FormulaC7H13O4P
Molecular Weight192.15 g/mol
Exact Mass192.06
IUPAC Name[(3E)-hexa-3,5-dienyl] methyl hydrogen phosphate
SMILESC=C/C=C/CCOP(=O)(O)OC
InChIInChI=1S/C7H13O4P/c1-3-4-5-6-7-11-12(8,9)10-2/h3-5H,1,6-7H2,2H3,(H,8,9)/b5-4+
InChIKeyYGWYJUWRDQXPBU-SNAWJCMRSA-N
XLogP1.88
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500192.15
LogP ≤ 51.88
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze [(3E)-hexa-3,5-dienyl] methyl hydrogen phosphate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(3E)-hexa-3,5-dienyl] methyl hydrogen phosphate?
The IUPAC name of [(3E)-hexa-3,5-dienyl] methyl hydrogen phosphate (CID 20726645) is [(3E)-hexa-3,5-dienyl] methyl hydrogen phosphate.
What is the SMILES notation for [(3E)-hexa-3,5-dienyl] methyl hydrogen phosphate?
The canonical SMILES for [(3E)-hexa-3,5-dienyl] methyl hydrogen phosphate is C=C/C=C/CCOP(=O)(O)OC.
What is the InChIKey of [(3E)-hexa-3,5-dienyl] methyl hydrogen phosphate?
The InChIKey is YGWYJUWRDQXPBU-SNAWJCMRSA-N. The full InChI is InChI=1S/C7H13O4P/c1-3-4-5-6-7-11-12(8,9)10-2/h3-5H,1,6-7H2,2H3,(H,8,9)/b5-4+.
What are the key properties of [(3E)-hexa-3,5-dienyl] methyl hydrogen phosphate?
[(3E)-hexa-3,5-dienyl] methyl hydrogen phosphate has a molecular weight of 192.15 g/mol, XLogP of 1.88, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3E)-hexa-3,5-dienyl] methyl hydrogen phosphate is sourced from PubChem (CID 20726645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).