C55H54N2O4 — CID 20726770
benzyl 2-[methyl-[1-[(2-methyl-2-phenylpropyl)amino]-1-oxo-3-(4-phenylmethoxyphenyl)propan-2-yl]amino]-3,3,3-triphenylpropanoate (PubChem CID 20726770) has the molecular formula C55H54N2O4 and a molecular weight of 807.05 g/mol. Its IUPAC name is benzyl 2-[methyl-[1-[(2-methyl-2-phenylpropyl)amino]-1-oxo-3-(4-phenylmethoxyphenyl)propan-2-yl]amino]-3,3,3-triphenylpropanoate.
| Compound Name | benzyl 2-[methyl-[1-[(2-methyl-2-phenylpropyl)amino]-1-oxo-3-(4-phenylmethoxyphenyl)propan-2-yl]amino]-3,3,3-triphenylpropanoate |
|---|---|
| PubChem CID | 20726770 |
| Molecular Formula | C55H54N2O4 |
| Molecular Weight | 807.05 g/mol |
| Exact Mass | 806.41 |
| IUPAC Name | benzyl 2-[methyl-[1-[(2-methyl-2-phenylpropyl)amino]-1-oxo-3-(4-phenylmethoxyphenyl)propan-2-yl]amino]-3,3,3-triphenylpropanoate |
| SMILES | CN(C(Cc1ccc(OCc2ccccc2)cc1)C(=O)NCC(C)(C)c1ccccc1)C(C(=O)OCc1ccccc1)C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C55H54N2O4/c1-54(2,45-26-14-6-15-27-45)41-56-52(58)50(38-42-34-36-49(37-35-42)60-39-43-22-10-4-11-23-43)57(3)51(53(59)61-40-44-24-12-5-13-25-44)55(46-28-16-7-17-29-46,47-30-18-8-19-31-47)48-32-20-9-21-33-48/h4-37,50-51H,38-41H2,1-3H3,(H,56,58) |
| InChIKey | JZAQPMOZAUBLKV-UHFFFAOYSA-N |
| XLogP | 10.35 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.05 |
| LogP ≤ 5 | 10.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|