C53H50N2O4 — CID 20726772
benzyl 2-[methyl-[1-oxo-1-(2-phenylethylamino)-3-(4-phenylmethoxyphenyl)propan-2-yl]amino]-3,3,3-triphenylpropanoate (PubChem CID 20726772) has the molecular formula C53H50N2O4 and a molecular weight of 778.99 g/mol. Its IUPAC name is benzyl 2-[methyl-[1-oxo-1-(2-phenylethylamino)-3-(4-phenylmethoxyphenyl)propan-2-yl]amino]-3,3,3-triphenylpropanoate.
| Compound Name | benzyl 2-[methyl-[1-oxo-1-(2-phenylethylamino)-3-(4-phenylmethoxyphenyl)propan-2-yl]amino]-3,3,3-triphenylpropanoate |
|---|---|
| PubChem CID | 20726772 |
| Molecular Formula | C53H50N2O4 |
| Molecular Weight | 778.99 g/mol |
| Exact Mass | 778.38 |
| IUPAC Name | benzyl 2-[methyl-[1-oxo-1-(2-phenylethylamino)-3-(4-phenylmethoxyphenyl)propan-2-yl]amino]-3,3,3-triphenylpropanoate |
| SMILES | CN(C(Cc1ccc(OCc2ccccc2)cc1)C(=O)NCCc1ccccc1)C(C(=O)OCc1ccccc1)C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C53H50N2O4/c1-55(49(51(56)54-37-36-41-20-8-2-9-21-41)38-42-32-34-48(35-33-42)58-39-43-22-10-3-11-23-43)50(52(57)59-40-44-24-12-4-13-25-44)53(45-26-14-5-15-27-45,46-28-16-6-17-29-46)47-30-18-7-19-31-47/h2-35,49-50H,36-40H2,1H3,(H,54,56) |
| InChIKey | ZTTYSVGUISBKDM-UHFFFAOYSA-N |
| XLogP | 9.61 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.99 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|