C32H41F5O4 — CID 20726828
10-[6-hydroxy-2-(4-hydroxyphenyl)-2-methyl-3,4-dihydro-1H-naphthalen-1-yl]-2-(4,4,5,5,5-pentafluoropentyl)decanoic acid (PubChem CID 20726828) has the molecular formula C32H41F5O4 and a molecular weight of 584.67 g/mol. Its IUPAC name is 10-[6-hydroxy-2-(4-hydroxyphenyl)-2-methyl-3,4-dihydro-1H-naphthalen-1-yl]-2-(4,4,5,5,5-pentafluoropentyl)decanoic acid.
| Compound Name | 10-[6-hydroxy-2-(4-hydroxyphenyl)-2-methyl-3,4-dihydro-1H-naphthalen-1-yl]-2-(4,4,5,5,5-pentafluoropentyl)decanoic acid |
|---|---|
| PubChem CID | 20726828 |
| Molecular Formula | C32H41F5O4 |
| Molecular Weight | 584.67 g/mol |
| Exact Mass | 584.29 |
| IUPAC Name | 10-[6-hydroxy-2-(4-hydroxyphenyl)-2-methyl-3,4-dihydro-1H-naphthalen-1-yl]-2-(4,4,5,5,5-pentafluoropentyl)decanoic acid |
| SMILES | CC1(c2ccc(O)cc2)CCc2cc(O)ccc2C1CCCCCCCCC(CCCC(F)(F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C32H41F5O4/c1-30(24-12-14-25(38)15-13-24)20-18-23-21-26(39)16-17-27(23)28(30)11-7-5-3-2-4-6-9-22(29(40)41)10-8-19-31(33,34)32(35,36)37/h12-17,21-22,28,38-39H,2-11,18-20H2,1H3,(H,40,41) |
| InChIKey | MVLHFOCLAGPANV-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.67 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|