C13H22ClF5 — CID 20726836
11-chloro-1,1,1,2,2-pentafluoro-6,6-dimethylundecane (PubChem CID 20726836) has the molecular formula C13H22ClF5 and a molecular weight of 308.76 g/mol. Its IUPAC name is 11-chloro-1,1,1,2,2-pentafluoro-6,6-dimethylundecane.
| Compound Name | 11-chloro-1,1,1,2,2-pentafluoro-6,6-dimethylundecane |
|---|---|
| PubChem CID | 20726836 |
| Molecular Formula | C13H22ClF5 |
| Molecular Weight | 308.76 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 11-chloro-1,1,1,2,2-pentafluoro-6,6-dimethylundecane |
| SMILES | CC(C)(CCCCCCl)CCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H22ClF5/c1-11(2,7-4-3-5-10-14)8-6-9-12(15,16)13(17,18)19/h3-10H2,1-2H3 |
| InChIKey | IQHPPMISDYPQPA-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.76 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|