About 1-ethyl-3,5-dimethoxycyclohexane
1-ethyl-3,5-dimethoxycyclohexane (PubChem CID 20726910) has the molecular formula C10H20O2
and a molecular weight of 172.27 g/mol. Its IUPAC name is 1-ethyl-3,5-dimethoxycyclohexane.
Molecular Properties
| Compound Name | 1-ethyl-3,5-dimethoxycyclohexane |
| PubChem CID | 20726910 |
| Molecular Formula | C10H20O2 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.15 |
| IUPAC Name | 1-ethyl-3,5-dimethoxycyclohexane |
| SMILES | CCC1CC(OC)CC(OC)C1 |
| InChI | InChI=1S/C10H20O2/c1-4-8-5-9(11-2)7-10(6-8)12-3/h8-10H,4-7H2,1-3H3 |
| InChIKey | NEOZDZRCRSSJIL-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-ethyl-3,5-dimethoxycyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3,5-dimethoxycyclohexane?
The IUPAC name of 1-ethyl-3,5-dimethoxycyclohexane (CID 20726910) is 1-ethyl-3,5-dimethoxycyclohexane.
What is the SMILES notation for 1-ethyl-3,5-dimethoxycyclohexane?
The canonical SMILES for 1-ethyl-3,5-dimethoxycyclohexane is CCC1CC(OC)CC(OC)C1.
What is the InChIKey of 1-ethyl-3,5-dimethoxycyclohexane?
The InChIKey is NEOZDZRCRSSJIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O2/c1-4-8-5-9(11-2)7-10(6-8)12-3/h8-10H,4-7H2,1-3H3.
What are the key properties of 1-ethyl-3,5-dimethoxycyclohexane?
1-ethyl-3,5-dimethoxycyclohexane has a molecular weight of 172.27 g/mol, XLogP of 2.23, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3,5-dimethoxycyclohexane is sourced from PubChem (CID 20726910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).