C34H22F6N2O4 — CID 20727116
5-[1,1,1,3,3,3-hexafluoro-2-[2-[4-[(4-methylphenyl)methyl]phenyl]-1,3-dioxoisoindol-5-yl]propan-2-yl]-2-methylisoindole-1,3-dione (PubChem CID 20727116) has the molecular formula C34H22F6N2O4 and a molecular weight of 636.55 g/mol. Its IUPAC name is 5-[1,1,1,3,3,3-hexafluoro-2-[2-[4-[(4-methylphenyl)methyl]phenyl]-1,3-dioxoisoindol-5-yl]propan-2-yl]-2-methylisoindole-1,3-dione.
| Compound Name | 5-[1,1,1,3,3,3-hexafluoro-2-[2-[4-[(4-methylphenyl)methyl]phenyl]-1,3-dioxoisoindol-5-yl]propan-2-yl]-2-methylisoindole-1,3-dione |
|---|---|
| PubChem CID | 20727116 |
| Molecular Formula | C34H22F6N2O4 |
| Molecular Weight | 636.55 g/mol |
| Exact Mass | 636.15 |
| IUPAC Name | 5-[1,1,1,3,3,3-hexafluoro-2-[2-[4-[(4-methylphenyl)methyl]phenyl]-1,3-dioxoisoindol-5-yl]propan-2-yl]-2-methylisoindole-1,3-dione |
| SMILES | Cc1ccc(Cc2ccc(N3C(=O)c4ccc(C(c5ccc6c(c5)C(=O)N(C)C6=O)(C(F)(F)F)C(F)(F)F)cc4C3=O)cc2)cc1 |
| InChI | InChI=1S/C34H22F6N2O4/c1-18-3-5-19(6-4-18)15-20-7-11-23(12-8-20)42-30(45)25-14-10-22(17-27(25)31(42)46)32(33(35,36)37,34(38,39)40)21-9-13-24-26(16-21)29(44)41(2)28(24)43/h3-14,16-17H,15H2,1-2H3 |
| InChIKey | OPEMBZJQRGXJKG-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.55 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|