About 8-methoxytricyclo[5.2.1.02,6]dec-3-ene
8-methoxytricyclo[5.2.1.02,6]dec-3-ene (PubChem CID 20727446) has the molecular formula C11H16O
and a molecular weight of 164.25 g/mol. Its IUPAC name is 8-methoxytricyclo[5.2.1.02,6]dec-3-ene.
Molecular Properties
| Compound Name | 8-methoxytricyclo[5.2.1.02,6]dec-3-ene |
| PubChem CID | 20727446 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | 8-methoxytricyclo[5.2.1.02,6]dec-3-ene |
| SMILES | COC1CC2CC1C1CC=CC21 |
| InChI | InChI=1S/C11H16O/c1-12-11-6-7-5-10(11)9-4-2-3-8(7)9/h2-3,7-11H,4-6H2,1H3 |
| InChIKey | BWSXMZBSPFYLHZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8-methoxytricyclo[5.2.1.02,6]dec-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methoxytricyclo[5.2.1.02,6]dec-3-ene?
The IUPAC name of 8-methoxytricyclo[5.2.1.02,6]dec-3-ene (CID 20727446) is 8-methoxytricyclo[5.2.1.02,6]dec-3-ene.
What is the SMILES notation for 8-methoxytricyclo[5.2.1.02,6]dec-3-ene?
The canonical SMILES for 8-methoxytricyclo[5.2.1.02,6]dec-3-ene is COC1CC2CC1C1CC=CC21.
What is the InChIKey of 8-methoxytricyclo[5.2.1.02,6]dec-3-ene?
The InChIKey is BWSXMZBSPFYLHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O/c1-12-11-6-7-5-10(11)9-4-2-3-8(7)9/h2-3,7-11H,4-6H2,1H3.
What are the key properties of 8-methoxytricyclo[5.2.1.02,6]dec-3-ene?
8-methoxytricyclo[5.2.1.02,6]dec-3-ene has a molecular weight of 164.25 g/mol, XLogP of 2.23, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methoxytricyclo[5.2.1.02,6]dec-3-ene is sourced from PubChem (CID 20727446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).