C14H17N3O2S — CID 20727589
1,3-diethyl-5-(1-methyl-4-pyridinylidene)-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 20727589) has the molecular formula C14H17N3O2S and a molecular weight of 291.38 g/mol. Its IUPAC name is 1,3-diethyl-5-(1-methyl-4-pyridinylidene)-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 1,3-diethyl-5-(1-methyl-4-pyridinylidene)-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 20727589 |
| Molecular Formula | C14H17N3O2S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 1,3-diethyl-5-(1-methyl-4-pyridinylidene)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CCN1C(=O)C(=C2C=CN(C)C=C2)C(=O)N(CC)C1=S |
| InChI | InChI=1S/C14H17N3O2S/c1-4-16-12(18)11(10-6-8-15(3)9-7-10)13(19)17(5-2)14(16)20/h6-9H,4-5H2,1-3H3 |
| InChIKey | KYJZERXHSZOOPW-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|