C15H14F13NO — CID 20727660
1-[2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)azepan-1-yl]prop-2-en-1-one (PubChem CID 20727660) has the molecular formula C15H14F13NO and a molecular weight of 471.26 g/mol. Its IUPAC name is 1-[2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)azepan-1-yl]prop-2-en-1-one.
| Compound Name | 1-[2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)azepan-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 20727660 |
| Molecular Formula | C15H14F13NO |
| Molecular Weight | 471.26 g/mol |
| Exact Mass | 471.09 |
| IUPAC Name | 1-[2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)azepan-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCCCCC1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H14F13NO/c1-2-9(30)29-7-5-3-4-6-8(29)10(16,17)11(18,19)12(20,21)13(22,23)14(24,25)15(26,27)28/h2,8H,1,3-7H2 |
| InChIKey | QGXSUZPIMFRTCY-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.26 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|