C11H6F13NO — CID 20727661
1-[2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)aziridin-1-yl]prop-2-en-1-one (PubChem CID 20727661) has the molecular formula C11H6F13NO and a molecular weight of 415.15 g/mol. Its IUPAC name is 1-[2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)aziridin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)aziridin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 20727661 |
| Molecular Formula | C11H6F13NO |
| Molecular Weight | 415.15 g/mol |
| Exact Mass | 415.02 |
| IUPAC Name | 1-[2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)aziridin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H6F13NO/c1-2-5(26)25-3-4(25)6(12,13)7(14,15)8(16,17)9(18,19)10(20,21)11(22,23)24/h2,4H,1,3H2 |
| InChIKey | YBFBYBOPRCREND-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 20.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.15 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|