C10H8F9NO — CID 20727675
2-methyl-1-[2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)aziridin-1-yl]prop-2-en-1-one (PubChem CID 20727675) has the molecular formula C10H8F9NO and a molecular weight of 329.16 g/mol. Its IUPAC name is 2-methyl-1-[2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)aziridin-1-yl]prop-2-en-1-one.
| Compound Name | 2-methyl-1-[2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)aziridin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 20727675 |
| Molecular Formula | C10H8F9NO |
| Molecular Weight | 329.16 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | 2-methyl-1-[2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)aziridin-1-yl]prop-2-en-1-one |
| SMILES | C=C(C)C(=O)N1CC1C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H8F9NO/c1-4(2)6(21)20-3-5(20)7(11,12)8(13,14)9(15,16)10(17,18)19/h5H,1,3H2,2H3 |
| InChIKey | ZKBZCIAVIZOXOB-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 20.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.16 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|