C14H12F13NO — CID 20727677
2-methyl-1-[2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 20727677) has the molecular formula C14H12F13NO and a molecular weight of 457.23 g/mol. Its IUPAC name is 2-methyl-1-[2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 2-methyl-1-[2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 20727677 |
| Molecular Formula | C14H12F13NO |
| Molecular Weight | 457.23 g/mol |
| Exact Mass | 457.07 |
| IUPAC Name | 2-methyl-1-[2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=C(C)C(=O)N1CCCC1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H12F13NO/c1-6(2)8(29)28-5-3-4-7(28)9(15,16)10(17,18)11(19,20)12(21,22)13(23,24)14(25,26)27/h7H,1,3-5H2,2H3 |
| InChIKey | NJKFRYMRCFBOAK-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.23 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|