About N-(9-tricyclo[6.2.1.02,7]undecanyl)prop-2-enamide
N-(9-tricyclo[6.2.1.02,7]undecanyl)prop-2-enamide (PubChem CID 20727713) has the molecular formula C14H21NO
and a molecular weight of 219.33 g/mol. Its IUPAC name is N-(9-tricyclo[6.2.1.02,7]undecanyl)prop-2-enamide.
Molecular Properties
| Compound Name | N-(9-tricyclo[6.2.1.02,7]undecanyl)prop-2-enamide |
| PubChem CID | 20727713 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | N-(9-tricyclo[6.2.1.02,7]undecanyl)prop-2-enamide |
| SMILES | C=CC(=O)NC1CC2CC1C1CCCCC21 |
| InChI | InChI=1S/C14H21NO/c1-2-14(16)15-13-8-9-7-12(13)11-6-4-3-5-10(9)11/h2,9-13H,1,3-8H2,(H,15,16) |
| InChIKey | ALHCOUSXFWCMOZ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-(9-tricyclo[6.2.1.02,7]undecanyl)prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(9-tricyclo[6.2.1.02,7]undecanyl)prop-2-enamide?
The IUPAC name of N-(9-tricyclo[6.2.1.02,7]undecanyl)prop-2-enamide (CID 20727713) is N-(9-tricyclo[6.2.1.02,7]undecanyl)prop-2-enamide.
What is the SMILES notation for N-(9-tricyclo[6.2.1.02,7]undecanyl)prop-2-enamide?
The canonical SMILES for N-(9-tricyclo[6.2.1.02,7]undecanyl)prop-2-enamide is C=CC(=O)NC1CC2CC1C1CCCCC21.
What is the InChIKey of N-(9-tricyclo[6.2.1.02,7]undecanyl)prop-2-enamide?
The InChIKey is ALHCOUSXFWCMOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO/c1-2-14(16)15-13-8-9-7-12(13)11-6-4-3-5-10(9)11/h2,9-13H,1,3-8H2,(H,15,16).
What are the key properties of N-(9-tricyclo[6.2.1.02,7]undecanyl)prop-2-enamide?
N-(9-tricyclo[6.2.1.02,7]undecanyl)prop-2-enamide has a molecular weight of 219.33 g/mol, XLogP of 2.50, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(9-tricyclo[6.2.1.02,7]undecanyl)prop-2-enamide is sourced from PubChem (CID 20727713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).