C23H40O8 — CID 20727785
6-[2-(2,2-dimethylbutanoyloxy)ethoxycarbonyl]-4-methoxycarbonyl-2,2,4,6-tetramethyloctanoic acid (PubChem CID 20727785) has the molecular formula C23H40O8 and a molecular weight of 444.57 g/mol. Its IUPAC name is 6-[2-(2,2-dimethylbutanoyloxy)ethoxycarbonyl]-4-methoxycarbonyl-2,2,4,6-tetramethyloctanoic acid.
| Compound Name | 6-[2-(2,2-dimethylbutanoyloxy)ethoxycarbonyl]-4-methoxycarbonyl-2,2,4,6-tetramethyloctanoic acid |
|---|---|
| PubChem CID | 20727785 |
| Molecular Formula | C23H40O8 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.27 |
| IUPAC Name | 6-[2-(2,2-dimethylbutanoyloxy)ethoxycarbonyl]-4-methoxycarbonyl-2,2,4,6-tetramethyloctanoic acid |
| SMILES | CCC(C)(C)C(=O)OCCOC(=O)C(C)(CC)CC(C)(CC(C)(C)C(=O)O)C(=O)OC |
| InChI | InChI=1S/C23H40O8/c1-10-20(3,4)17(26)30-12-13-31-19(28)22(7,11-2)15-23(8,18(27)29-9)14-21(5,6)16(24)25/h10-15H2,1-9H3,(H,24,25) |
| InChIKey | LVAKVNHODRFLPQ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|