C10H13N3S — CID 20727882
3-(3-methylsulfanylpropyl)imidazo[4,5-b]pyridine (PubChem CID 20727882) has the molecular formula C10H13N3S and a molecular weight of 207.30 g/mol. Its IUPAC name is 3-(3-methylsulfanylpropyl)imidazo[4,5-b]pyridine.
| Compound Name | 3-(3-methylsulfanylpropyl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 20727882 |
| Molecular Formula | C10H13N3S |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 3-(3-methylsulfanylpropyl)imidazo[4,5-b]pyridine |
| SMILES | CSCCCn1cnc2cccnc21 |
| InChI | InChI=1S/C10H13N3S/c1-14-7-3-6-13-8-12-9-4-2-5-11-10(9)13/h2,4-5,8H,3,6-7H2,1H3 |
| InChIKey | YGXPEEGUGOARFV-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|