C18H18O3S — CID 20728321
(1aR,2R,8bS)-2-ethyl-8b-phenyl-2,3-dihydro-1aH-[1]benzothiepino[4,5-b]oxirene 4,4-dioxide (PubChem CID 20728321) has the molecular formula C18H18O3S and a molecular weight of 314.41 g/mol. Its IUPAC name is (1aR,2R,8bS)-2-ethyl-8b-phenyl-2,3-dihydro-1aH-[1]benzothiepino[4,5-b]oxirene 4,4-dioxide.
| Compound Name | (1aR,2R,8bS)-2-ethyl-8b-phenyl-2,3-dihydro-1aH-[1]benzothiepino[4,5-b]oxirene 4,4-dioxide |
|---|---|
| PubChem CID | 20728321 |
| Molecular Formula | C18H18O3S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | (1aR,2R,8bS)-2-ethyl-8b-phenyl-2,3-dihydro-1aH-[1]benzothiepino[4,5-b]oxirene 4,4-dioxide |
| SMILES | CC[C@H]1CS(=O)(=O)c2ccccc2[C@]2(c3ccccc3)O[C@H]12 |
| InChI | InChI=1S/C18H18O3S/c1-2-13-12-22(19,20)16-11-7-6-10-15(16)18(17(13)21-18)14-8-4-3-5-9-14/h3-11,13,17H,2,12H2,1H3/t13-,17+,18-/m0/s1 |
| InChIKey | YQZWBKFWLDMHKF-VHSSKADRSA-N |
| XLogP | 3.14 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|