About N'-butan-2-yl-N'-ethyl-N-(3-methylphenyl)pentane-1,5-diamine
N'-butan-2-yl-N'-ethyl-N-(3-methylphenyl)pentane-1,5-diamine (PubChem CID 20728490) has the molecular formula C18H32N2
and a molecular weight of 276.47 g/mol. Its IUPAC name is N'-butan-2-yl-N'-ethyl-N-(3-methylphenyl)pentane-1,5-diamine.
Molecular Properties
| Compound Name | N'-butan-2-yl-N'-ethyl-N-(3-methylphenyl)pentane-1,5-diamine |
| PubChem CID | 20728490 |
| Molecular Formula | C18H32N2 |
| Molecular Weight | 276.47 g/mol |
| Exact Mass | 276.26 |
| IUPAC Name | N'-butan-2-yl-N'-ethyl-N-(3-methylphenyl)pentane-1,5-diamine |
| SMILES | CCC(C)N(CC)CCCCCNc1cccc(C)c1 |
| InChI | InChI=1S/C18H32N2/c1-5-17(4)20(6-2)14-9-7-8-13-19-18-12-10-11-16(3)15-18/h10-12,15,17,19H,5-9,13-14H2,1-4H3 |
| InChIKey | OKFBINWFJSSIGJ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.47 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-butan-2-yl-N'-ethyl-N-(3-methylphenyl)pentane-1,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-butan-2-yl-N'-ethyl-N-(3-methylphenyl)pentane-1,5-diamine?
The IUPAC name of N'-butan-2-yl-N'-ethyl-N-(3-methylphenyl)pentane-1,5-diamine (CID 20728490) is N'-butan-2-yl-N'-ethyl-N-(3-methylphenyl)pentane-1,5-diamine.
What is the SMILES notation for N'-butan-2-yl-N'-ethyl-N-(3-methylphenyl)pentane-1,5-diamine?
The canonical SMILES for N'-butan-2-yl-N'-ethyl-N-(3-methylphenyl)pentane-1,5-diamine is CCC(C)N(CC)CCCCCNc1cccc(C)c1.
What is the InChIKey of N'-butan-2-yl-N'-ethyl-N-(3-methylphenyl)pentane-1,5-diamine?
The InChIKey is OKFBINWFJSSIGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32N2/c1-5-17(4)20(6-2)14-9-7-8-13-19-18-12-10-11-16(3)15-18/h10-12,15,17,19H,5-9,13-14H2,1-4H3.
What are the key properties of N'-butan-2-yl-N'-ethyl-N-(3-methylphenyl)pentane-1,5-diamine?
N'-butan-2-yl-N'-ethyl-N-(3-methylphenyl)pentane-1,5-diamine has a molecular weight of 276.47 g/mol, XLogP of 4.70, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-butan-2-yl-N'-ethyl-N-(3-methylphenyl)pentane-1,5-diamine is sourced from PubChem (CID 20728490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).