C16H31NO5 — CID 20728665
2-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)ethyl 4-methylperoxybutanoate (PubChem CID 20728665) has the molecular formula C16H31NO5 and a molecular weight of 317.43 g/mol. Its IUPAC name is 2-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)ethyl 4-methylperoxybutanoate.
| Compound Name | 2-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)ethyl 4-methylperoxybutanoate |
|---|---|
| PubChem CID | 20728665 |
| Molecular Formula | C16H31NO5 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.22 |
| IUPAC Name | 2-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)ethyl 4-methylperoxybutanoate |
| SMILES | COOCCCC(=O)OCCN1C(C)(C)CC(O)CC1(C)C |
| InChI | InChI=1S/C16H31NO5/c1-15(2)11-13(18)12-16(3,4)17(15)8-10-21-14(19)7-6-9-22-20-5/h13,18H,6-12H2,1-5H3 |
| InChIKey | PVGMHYZBODWSEG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|