C17H10Br4F6 — CID 20728680
1,3-dibromo-5-[2-(3,5-dibromo-4-methylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methylbenzene (PubChem CID 20728680) has the molecular formula C17H10Br4F6 and a molecular weight of 647.87 g/mol. Its IUPAC name is 1,3-dibromo-5-[2-(3,5-dibromo-4-methylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methylbenzene.
| Compound Name | 1,3-dibromo-5-[2-(3,5-dibromo-4-methylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methylbenzene |
|---|---|
| PubChem CID | 20728680 |
| Molecular Formula | C17H10Br4F6 |
| Molecular Weight | 647.87 g/mol |
| Exact Mass | 643.74 |
| IUPAC Name | 1,3-dibromo-5-[2-(3,5-dibromo-4-methylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methylbenzene |
| SMILES | Cc1c(Br)cc(C(c2cc(Br)c(C)c(Br)c2)(C(F)(F)F)C(F)(F)F)cc1Br |
| InChI | InChI=1S/C17H10Br4F6/c1-7-11(18)3-9(4-12(7)19)15(16(22,23)24,17(25,26)27)10-5-13(20)8(2)14(21)6-10/h3-6H,1-2H3 |
| InChIKey | ZCEMZLDVIYNTSN-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.87 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |