About 1-(4-benzylphenyl)-N-ethyl-2,2,2-trifluoroethanimine
1-(4-benzylphenyl)-N-ethyl-2,2,2-trifluoroethanimine (PubChem CID 20728923) has the molecular formula C17H16F3N
and a molecular weight of 291.32 g/mol. Its IUPAC name is 1-(4-benzylphenyl)-N-ethyl-2,2,2-trifluoroethanimine.
Molecular Properties
| Compound Name | 1-(4-benzylphenyl)-N-ethyl-2,2,2-trifluoroethanimine |
| PubChem CID | 20728923 |
| Molecular Formula | C17H16F3N |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 1-(4-benzylphenyl)-N-ethyl-2,2,2-trifluoroethanimine |
| SMILES | CC/N=C(\c1ccc(Cc2ccccc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C17H16F3N/c1-2-21-16(17(18,19)20)15-10-8-14(9-11-15)12-13-6-4-3-5-7-13/h3-11H,2,12H2,1H3/b21-16+ |
| InChIKey | QKRWVBALHWSCCB-LTGZKZEYSA-N |
| XLogP | 4.65 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-benzylphenyl)-N-ethyl-2,2,2-trifluoroethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-benzylphenyl)-N-ethyl-2,2,2-trifluoroethanimine?
The IUPAC name of 1-(4-benzylphenyl)-N-ethyl-2,2,2-trifluoroethanimine (CID 20728923) is 1-(4-benzylphenyl)-N-ethyl-2,2,2-trifluoroethanimine.
What is the SMILES notation for 1-(4-benzylphenyl)-N-ethyl-2,2,2-trifluoroethanimine?
The canonical SMILES for 1-(4-benzylphenyl)-N-ethyl-2,2,2-trifluoroethanimine is CC/N=C(\c1ccc(Cc2ccccc2)cc1)C(F)(F)F.
What is the InChIKey of 1-(4-benzylphenyl)-N-ethyl-2,2,2-trifluoroethanimine?
The InChIKey is QKRWVBALHWSCCB-LTGZKZEYSA-N. The full InChI is InChI=1S/C17H16F3N/c1-2-21-16(17(18,19)20)15-10-8-14(9-11-15)12-13-6-4-3-5-7-13/h3-11H,2,12H2,1H3/b21-16+.
What are the key properties of 1-(4-benzylphenyl)-N-ethyl-2,2,2-trifluoroethanimine?
1-(4-benzylphenyl)-N-ethyl-2,2,2-trifluoroethanimine has a molecular weight of 291.32 g/mol, XLogP of 4.65, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-benzylphenyl)-N-ethyl-2,2,2-trifluoroethanimine is sourced from PubChem (CID 20728923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).