C23H24F6N2O5S — CID 20728927
(Z)-2,2,2-trifluoro-N-methyl-1-[4-[3-[4-[(Z)-N-propylsulfanyloxyperoxy-C-(trifluoromethyl)carbonimidoyl]phenoxy]propoxy]phenyl]ethanimine (PubChem CID 20728927) has the molecular formula C23H24F6N2O5S and a molecular weight of 554.51 g/mol. Its IUPAC name is (Z)-2,2,2-trifluoro-N-methyl-1-[4-[3-[4-[(Z)-N-propylsulfanyloxyperoxy-C-(trifluoromethyl)carbonimidoyl]phenoxy]propoxy]phenyl]ethanimine.
| Compound Name | (Z)-2,2,2-trifluoro-N-methyl-1-[4-[3-[4-[(Z)-N-propylsulfanyloxyperoxy-C-(trifluoromethyl)carbonimidoyl]phenoxy]propoxy]phenyl]ethanimine |
|---|---|
| PubChem CID | 20728927 |
| Molecular Formula | C23H24F6N2O5S |
| Molecular Weight | 554.51 g/mol |
| Exact Mass | 554.13 |
| IUPAC Name | (Z)-2,2,2-trifluoro-N-methyl-1-[4-[3-[4-[(Z)-N-propylsulfanyloxyperoxy-C-(trifluoromethyl)carbonimidoyl]phenoxy]propoxy]phenyl]ethanimine |
| SMILES | CCCSOOO/N=C(/c1ccc(OCCCOc2ccc(/C(=N\C)C(F)(F)F)cc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C23H24F6N2O5S/c1-3-15-37-36-35-34-31-21(23(27,28)29)17-7-11-19(12-8-17)33-14-4-13-32-18-9-5-16(6-10-18)20(30-2)22(24,25)26/h5-12H,3-4,13-15H2,1-2H3/b30-20+,31-21- |
| InChIKey | CRXBUHDLXAEGPZ-FEGSLFPESA-N |
| XLogP | 6.72 |
| TPSA | 70.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.51 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|