About 4-diazo-2,2,6,6-tetramethylheptane
4-diazo-2,2,6,6-tetramethylheptane (PubChem CID 20728936) has the molecular formula C11H22N2
and a molecular weight of 182.31 g/mol. Its IUPAC name is 4-diazo-2,2,6,6-tetramethylheptane.
Molecular Properties
| Compound Name | 4-diazo-2,2,6,6-tetramethylheptane |
| PubChem CID | 20728936 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | 4-diazo-2,2,6,6-tetramethylheptane |
| SMILES | CC(C)(C)CC(CC(C)(C)C)=[N+]=[N-] |
| InChI | InChI=1S/C11H22N2/c1-10(2,3)7-9(13-12)8-11(4,5)6/h7-8H2,1-6H3 |
| InChIKey | ZADBJAZNCOZFJX-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 4-diazo-2,2,6,6-tetramethylheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-diazo-2,2,6,6-tetramethylheptane?
The IUPAC name of 4-diazo-2,2,6,6-tetramethylheptane (CID 20728936) is 4-diazo-2,2,6,6-tetramethylheptane.
What is the SMILES notation for 4-diazo-2,2,6,6-tetramethylheptane?
The canonical SMILES for 4-diazo-2,2,6,6-tetramethylheptane is CC(C)(C)CC(CC(C)(C)C)=[N+]=[N-].
What is the InChIKey of 4-diazo-2,2,6,6-tetramethylheptane?
The InChIKey is ZADBJAZNCOZFJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2/c1-10(2,3)7-9(13-12)8-11(4,5)6/h7-8H2,1-6H3.
What are the key properties of 4-diazo-2,2,6,6-tetramethylheptane?
4-diazo-2,2,6,6-tetramethylheptane has a molecular weight of 182.31 g/mol, XLogP of 3.53, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-diazo-2,2,6,6-tetramethylheptane is sourced from PubChem (CID 20728936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).