C35H31F6N2+ — CID 20729185
(2E)-2-[(E)-3-[1,1-dimethyl-3-(2,2,2-trifluoroethyl)benzo[e]indol-3-ium-2-yl]prop-2-enylidene]-1,1-dimethyl-3-(2,2,2-trifluoroethyl)benzo[e]indole (PubChem CID 20729185) has the molecular formula C35H31F6N2+ and a molecular weight of 593.64 g/mol. Its IUPAC name is (2E)-2-[(E)-3-[1,1-dimethyl-3-(2,2,2-trifluoroethyl)benzo[e]indol-3-ium-2-yl]prop-2-enylidene]-1,1-dimethyl-3-(2,2,2-trifluoroethyl)benzo[e]indole.
| Compound Name | (2E)-2-[(E)-3-[1,1-dimethyl-3-(2,2,2-trifluoroethyl)benzo[e]indol-3-ium-2-yl]prop-2-enylidene]-1,1-dimethyl-3-(2,2,2-trifluoroethyl)benzo[e]indole |
|---|---|
| PubChem CID | 20729185 |
| Molecular Formula | C35H31F6N2+ |
| Molecular Weight | 593.64 g/mol |
| Exact Mass | 593.24 |
| IUPAC Name | (2E)-2-[(E)-3-[1,1-dimethyl-3-(2,2,2-trifluoroethyl)benzo[e]indol-3-ium-2-yl]prop-2-enylidene]-1,1-dimethyl-3-(2,2,2-trifluoroethyl)benzo[e]indole |
| SMILES | CC1(C)C(/C=C/C=C2/N(CC(F)(F)F)c3ccc4ccccc4c3C2(C)C)=[N+](CC(F)(F)F)c2ccc3ccccc3c21 |
| InChI | InChI=1S/C35H31F6N2/c1-32(2)28(42(20-34(36,37)38)26-18-16-22-10-5-7-12-24(22)30(26)32)14-9-15-29-33(3,4)31-25-13-8-6-11-23(25)17-19-27(31)43(29)21-35(39,40)41/h5-19H,20-21H2,1-4H3/q+1 |
| InChIKey | GRTSLRYFOWOIPM-UHFFFAOYSA-N |
| XLogP | 9.73 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.64 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|