About [2,5-bis[2-(2-butoxyphenoxy)ethoxy]-4-(4-methoxyphenyl)phenyl]diazene
[2,5-bis[2-(2-butoxyphenoxy)ethoxy]-4-(4-methoxyphenyl)phenyl]diazene (PubChem CID 20729262) has the molecular formula C37H44N2O7
and a molecular weight of 628.77 g/mol. Its IUPAC name is [2,5-bis[2-(2-butoxyphenoxy)ethoxy]-4-(4-methoxyphenyl)phenyl]diazene.
Molecular Properties
| Compound Name | [2,5-bis[2-(2-butoxyphenoxy)ethoxy]-4-(4-methoxyphenyl)phenyl]diazene |
| PubChem CID | 20729262 |
| Molecular Formula | C37H44N2O7 |
| Molecular Weight | 628.77 g/mol |
| Exact Mass | 628.31 |
| IUPAC Name | [2,5-bis[2-(2-butoxyphenoxy)ethoxy]-4-(4-methoxyphenyl)phenyl]diazene |
| SMILES | [H]/N=N/c1cc(OCCOc2ccccc2OCCCC)c(-c2ccc(OC)cc2)cc1OCCOc1ccccc1OCCCC |
| InChI | InChI=1S/C37H44N2O7/c1-4-6-20-41-32-12-8-10-14-34(32)43-22-24-45-36-27-31(39-38)37(26-30(36)28-16-18-29(40-3)19-17-28)46-25-23-44-35-15-11-9-13-33(35)42-21-7-5-2/h8-19,26-27,38H,4-7,20-25H2,1-3H3/b39-38+ |
| InChIKey | RTLASCMABUSVGY-YMZYAJTMSA-N |
| XLogP | 9.30 |
| TPSA | 100.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 628.77 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze [2,5-bis[2-(2-butoxyphenoxy)ethoxy]-4-(4-methoxyphenyl)phenyl]diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,5-bis[2-(2-butoxyphenoxy)ethoxy]-4-(4-methoxyphenyl)phenyl]diazene?
The IUPAC name of [2,5-bis[2-(2-butoxyphenoxy)ethoxy]-4-(4-methoxyphenyl)phenyl]diazene (CID 20729262) is [2,5-bis[2-(2-butoxyphenoxy)ethoxy]-4-(4-methoxyphenyl)phenyl]diazene.
What is the SMILES notation for [2,5-bis[2-(2-butoxyphenoxy)ethoxy]-4-(4-methoxyphenyl)phenyl]diazene?
The canonical SMILES for [2,5-bis[2-(2-butoxyphenoxy)ethoxy]-4-(4-methoxyphenyl)phenyl]diazene is [H]/N=N/c1cc(OCCOc2ccccc2OCCCC)c(-c2ccc(OC)cc2)cc1OCCOc1ccccc1OCCCC.
What is the InChIKey of [2,5-bis[2-(2-butoxyphenoxy)ethoxy]-4-(4-methoxyphenyl)phenyl]diazene?
The InChIKey is RTLASCMABUSVGY-YMZYAJTMSA-N. The full InChI is InChI=1S/C37H44N2O7/c1-4-6-20-41-32-12-8-10-14-34(32)43-22-24-45-36-27-31(39-38)37(26-30(36)28-16-18-29(40-3)19-17-28)46-25-23-44-35-15-11-9-13-33(35)42-21-7-5-2/h8-19,26-27,38H,4-7,20-25H2,1-3H3/b39-38+.
What are the key properties of [2,5-bis[2-(2-butoxyphenoxy)ethoxy]-4-(4-methoxyphenyl)phenyl]diazene?
[2,5-bis[2-(2-butoxyphenoxy)ethoxy]-4-(4-methoxyphenyl)phenyl]diazene has a molecular weight of 628.77 g/mol, XLogP of 9.30, 21 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [2,5-bis[2-(2-butoxyphenoxy)ethoxy]-4-(4-methoxyphenyl)phenyl]diazene is sourced from PubChem (CID 20729262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).