C19H28FNO4S — CID 20729719
tert-butyl N-[(1S,3R)-3-[2-(3-fluorophenyl)sulfonylethyl]cyclohexyl]carbamate (PubChem CID 20729719) has the molecular formula C19H28FNO4S and a molecular weight of 385.50 g/mol. Its IUPAC name is tert-butyl N-[(1S,3R)-3-[2-(3-fluorophenyl)sulfonylethyl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(1S,3R)-3-[2-(3-fluorophenyl)sulfonylethyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 20729719 |
| Molecular Formula | C19H28FNO4S |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | tert-butyl N-[(1S,3R)-3-[2-(3-fluorophenyl)sulfonylethyl]cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCC[C@@H](CCS(=O)(=O)c2cccc(F)c2)C1 |
| InChI | InChI=1S/C19H28FNO4S/c1-19(2,3)25-18(22)21-16-8-4-6-14(12-16)10-11-26(23,24)17-9-5-7-15(20)13-17/h5,7,9,13-14,16H,4,6,8,10-12H2,1-3H3,(H,21,22)/t14-,16-/m0/s1 |
| InChIKey | RVJSHKQPFKHTCR-HOCLYGCPSA-N |
| XLogP | 4.07 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |