C9H9F6NOS — CID 20729841
1,1,1,3,3,3-hexafluoro-2-(5-propan-2-yl-1,3-thiazol-2-yl)propan-2-ol (PubChem CID 20729841) has the molecular formula C9H9F6NOS and a molecular weight of 293.23 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-(5-propan-2-yl-1,3-thiazol-2-yl)propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-(5-propan-2-yl-1,3-thiazol-2-yl)propan-2-ol |
|---|---|
| PubChem CID | 20729841 |
| Molecular Formula | C9H9F6NOS |
| Molecular Weight | 293.23 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-(5-propan-2-yl-1,3-thiazol-2-yl)propan-2-ol |
| SMILES | CC(C)c1cnc(C(O)(C(F)(F)F)C(F)(F)F)s1 |
| InChI | InChI=1S/C9H9F6NOS/c1-4(2)5-3-16-6(18-5)7(17,8(10,11)12)9(13,14)15/h3-4,17H,1-2H3 |
| InChIKey | NOLBMJCJMWWPLC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.23 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |