C17H38N3O+ — CID 20730080
[2-hydroxy-2-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]ethyl]-(2-methylbutyl)azanium (PubChem CID 20730080) has the molecular formula C17H38N3O+ and a molecular weight of 300.51 g/mol. Its IUPAC name is [2-hydroxy-2-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]ethyl]-(2-methylbutyl)azanium.
| Compound Name | [2-hydroxy-2-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]ethyl]-(2-methylbutyl)azanium |
|---|---|
| PubChem CID | 20730080 |
| Molecular Formula | C17H38N3O+ |
| Molecular Weight | 300.51 g/mol |
| Exact Mass | 300.30 |
| IUPAC Name | [2-hydroxy-2-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]ethyl]-(2-methylbutyl)azanium |
| SMILES | CCC(C)C[NH2+]CC(O)NC1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C17H37N3O/c1-8-13(2)11-18-12-15(21)19-14-9-16(3,4)20(7)17(5,6)10-14/h13-15,18-19,21H,8-12H2,1-7H3/p+1 |
| InChIKey | AWJPGGCKSWYUCR-UHFFFAOYSA-O |
| XLogP | 1.16 |
| TPSA | 52.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.51 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|