C20H28N2O4 — CID 20730125
2,9-bis(3-ethenoxypropyl)-1,3,8,10-tetrahydro-[1,3]oxazino[5,6-f][1,3]benzoxazine (PubChem CID 20730125) has the molecular formula C20H28N2O4 and a molecular weight of 360.45 g/mol. Its IUPAC name is 2,9-bis(3-ethenoxypropyl)-1,3,8,10-tetrahydro-[1,3]oxazino[5,6-f][1,3]benzoxazine.
| Compound Name | 2,9-bis(3-ethenoxypropyl)-1,3,8,10-tetrahydro-[1,3]oxazino[5,6-f][1,3]benzoxazine |
|---|---|
| PubChem CID | 20730125 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 2,9-bis(3-ethenoxypropyl)-1,3,8,10-tetrahydro-[1,3]oxazino[5,6-f][1,3]benzoxazine |
| SMILES | C=COCCCN1COc2ccc3c(c2C1)CN(CCCOC=C)CO3 |
| InChI | InChI=1S/C20H28N2O4/c1-3-23-11-5-9-21-13-17-18-14-22(10-6-12-24-4-2)16-26-20(18)8-7-19(17)25-15-21/h3-4,7-8H,1-2,5-6,9-16H2 |
| InChIKey | WHOJHMQZZOQMCG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|