About N-methylidene-N'-(6-methylidenepyridazin-3-ylidene)oxamide
N-methylidene-N'-(6-methylidenepyridazin-3-ylidene)oxamide (PubChem CID 20730148) has the molecular formula C8H6N4O2
and a molecular weight of 190.16 g/mol. Its IUPAC name is N-methylidene-N'-(6-methylidenepyridazin-3-ylidene)oxamide.
Molecular Properties
| Compound Name | N-methylidene-N'-(6-methylidenepyridazin-3-ylidene)oxamide |
| PubChem CID | 20730148 |
| Molecular Formula | C8H6N4O2 |
| Molecular Weight | 190.16 g/mol |
| Exact Mass | 190.05 |
| IUPAC Name | N-methylidene-N'-(6-methylidenepyridazin-3-ylidene)oxamide |
| SMILES | C=NC(=O)C(=O)/N=C1\C=CC(=C)N=N1 |
| InChI | InChI=1S/C8H6N4O2/c1-5-3-4-6(12-11-5)10-8(14)7(13)9-2/h3-4H,1-2H2/b10-6+ |
| InChIKey | DIUCSAMVOFZULZ-UXBLZVDNSA-N |
| XLogP | 0.67 |
| TPSA | 83.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.16 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-methylidene-N'-(6-methylidenepyridazin-3-ylidene)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylidene-N'-(6-methylidenepyridazin-3-ylidene)oxamide?
The IUPAC name of N-methylidene-N'-(6-methylidenepyridazin-3-ylidene)oxamide (CID 20730148) is N-methylidene-N'-(6-methylidenepyridazin-3-ylidene)oxamide.
What is the SMILES notation for N-methylidene-N'-(6-methylidenepyridazin-3-ylidene)oxamide?
The canonical SMILES for N-methylidene-N'-(6-methylidenepyridazin-3-ylidene)oxamide is C=NC(=O)C(=O)/N=C1\C=CC(=C)N=N1.
What is the InChIKey of N-methylidene-N'-(6-methylidenepyridazin-3-ylidene)oxamide?
The InChIKey is DIUCSAMVOFZULZ-UXBLZVDNSA-N. The full InChI is InChI=1S/C8H6N4O2/c1-5-3-4-6(12-11-5)10-8(14)7(13)9-2/h3-4H,1-2H2/b10-6+.
What are the key properties of N-methylidene-N'-(6-methylidenepyridazin-3-ylidene)oxamide?
N-methylidene-N'-(6-methylidenepyridazin-3-ylidene)oxamide has a molecular weight of 190.16 g/mol, XLogP of 0.67, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylidene-N'-(6-methylidenepyridazin-3-ylidene)oxamide is sourced from PubChem (CID 20730148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).