C36H32F6O6 — CID 20730194
[4-[2-(4-acetyloxyphenyl)-5-hydroxypentan-2-yl]phenyl] 4-[1,1,1,3,3,3-hexafluoro-2-(4-methoxyphenyl)propan-2-yl]benzoate (PubChem CID 20730194) has the molecular formula C36H32F6O6 and a molecular weight of 674.63 g/mol. Its IUPAC name is [4-[2-(4-acetyloxyphenyl)-5-hydroxypentan-2-yl]phenyl] 4-[1,1,1,3,3,3-hexafluoro-2-(4-methoxyphenyl)propan-2-yl]benzoate.
| Compound Name | [4-[2-(4-acetyloxyphenyl)-5-hydroxypentan-2-yl]phenyl] 4-[1,1,1,3,3,3-hexafluoro-2-(4-methoxyphenyl)propan-2-yl]benzoate |
|---|---|
| PubChem CID | 20730194 |
| Molecular Formula | C36H32F6O6 |
| Molecular Weight | 674.63 g/mol |
| Exact Mass | 674.21 |
| IUPAC Name | [4-[2-(4-acetyloxyphenyl)-5-hydroxypentan-2-yl]phenyl] 4-[1,1,1,3,3,3-hexafluoro-2-(4-methoxyphenyl)propan-2-yl]benzoate |
| SMILES | COc1ccc(C(c2ccc(C(=O)Oc3ccc(C(C)(CCCO)c4ccc(OC(C)=O)cc4)cc3)cc2)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C36H32F6O6/c1-23(44)47-30-17-9-25(10-18-30)33(2,21-4-22-43)26-11-19-31(20-12-26)48-32(45)24-5-7-27(8-6-24)34(35(37,38)39,36(40,41)42)28-13-15-29(46-3)16-14-28/h5-20,43H,4,21-22H2,1-3H3 |
| InChIKey | OHWNDSNTWQOSBX-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.63 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|