C35H32F4O5 — CID 20730198
[4-[2-(4-acetylphenyl)-5-hydroxypentan-2-yl]phenyl] 4-[1,2,2,2-tetrafluoro-1-(4-methoxyphenyl)ethyl]benzoate (PubChem CID 20730198) has the molecular formula C35H32F4O5 and a molecular weight of 608.63 g/mol. Its IUPAC name is [4-[2-(4-acetylphenyl)-5-hydroxypentan-2-yl]phenyl] 4-[1,2,2,2-tetrafluoro-1-(4-methoxyphenyl)ethyl]benzoate.
| Compound Name | [4-[2-(4-acetylphenyl)-5-hydroxypentan-2-yl]phenyl] 4-[1,2,2,2-tetrafluoro-1-(4-methoxyphenyl)ethyl]benzoate |
|---|---|
| PubChem CID | 20730198 |
| Molecular Formula | C35H32F4O5 |
| Molecular Weight | 608.63 g/mol |
| Exact Mass | 608.22 |
| IUPAC Name | [4-[2-(4-acetylphenyl)-5-hydroxypentan-2-yl]phenyl] 4-[1,2,2,2-tetrafluoro-1-(4-methoxyphenyl)ethyl]benzoate |
| SMILES | COc1ccc(C(F)(c2ccc(C(=O)Oc3ccc(C(C)(CCCO)c4ccc(C(C)=O)cc4)cc3)cc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C35H32F4O5/c1-23(41)24-5-9-26(10-6-24)33(2,21-4-22-40)27-13-19-31(20-14-27)44-32(42)25-7-11-28(12-8-25)34(36,35(37,38)39)29-15-17-30(43-3)18-16-29/h5-20,40H,4,21-22H2,1-3H3 |
| InChIKey | HSYBFKZVOXCKHP-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.63 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|