C30H32O6P2 — CID 20730418
phenyl-[3,4,5-trimethoxy-2-(2,3,4-trimethoxy-6-phenylphosphanylphenyl)phenyl]phosphane (PubChem CID 20730418) has the molecular formula C30H32O6P2 and a molecular weight of 550.53 g/mol. Its IUPAC name is phenyl-[3,4,5-trimethoxy-2-(2,3,4-trimethoxy-6-phenylphosphanylphenyl)phenyl]phosphane.
| Compound Name | phenyl-[3,4,5-trimethoxy-2-(2,3,4-trimethoxy-6-phenylphosphanylphenyl)phenyl]phosphane |
|---|---|
| PubChem CID | 20730418 |
| Molecular Formula | C30H32O6P2 |
| Molecular Weight | 550.53 g/mol |
| Exact Mass | 550.17 |
| IUPAC Name | phenyl-[3,4,5-trimethoxy-2-(2,3,4-trimethoxy-6-phenylphosphanylphenyl)phenyl]phosphane |
| SMILES | COc1cc(Pc2ccccc2)c(-c2c(Pc3ccccc3)cc(OC)c(OC)c2OC)c(OC)c1OC |
| InChI | InChI=1S/C30H32O6P2/c1-31-21-17-23(37-19-13-9-7-10-14-19)25(29(35-5)27(21)33-3)26-24(38-20-15-11-8-12-16-20)18-22(32-2)28(34-4)30(26)36-6/h7-18,37-38H,1-6H3 |
| InChIKey | KIJAGHBJBYDXMP-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.53 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|