C68H66N2 — CID 20731073
1-N,4-N-bis[4-[(E)-2-[4-(cyclohexylidenemethyl)phenyl]ethenyl]phenyl]-2,3-dimethyl-1-N,4-N-bis(4-methylphenyl)naphthalene-1,4-diamine (PubChem CID 20731073) has the molecular formula C68H66N2 and a molecular weight of 911.29 g/mol. Its IUPAC name is 1-N,4-N-bis[4-[(E)-2-[4-(cyclohexylidenemethyl)phenyl]ethenyl]phenyl]-2,3-dimethyl-1-N,4-N-bis(4-methylphenyl)naphthalene-1,4-diamine.
| Compound Name | 1-N,4-N-bis[4-[(E)-2-[4-(cyclohexylidenemethyl)phenyl]ethenyl]phenyl]-2,3-dimethyl-1-N,4-N-bis(4-methylphenyl)naphthalene-1,4-diamine |
|---|---|
| PubChem CID | 20731073 |
| Molecular Formula | C68H66N2 |
| Molecular Weight | 911.29 g/mol |
| Exact Mass | 910.52 |
| IUPAC Name | 1-N,4-N-bis[4-[(E)-2-[4-(cyclohexylidenemethyl)phenyl]ethenyl]phenyl]-2,3-dimethyl-1-N,4-N-bis(4-methylphenyl)naphthalene-1,4-diamine |
| SMILES | Cc1ccc(N(c2ccc(/C=C/c3ccc(C=C4CCCCC4)cc3)cc2)c2c(C)c(C)c(N(c3ccc(C)cc3)c3ccc(/C=C/c4ccc(C=C5CCCCC5)cc4)cc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C68H66N2/c1-49-19-39-61(40-20-49)69(63-43-35-55(36-44-63)25-23-53-27-31-59(32-28-53)47-57-13-7-5-8-14-57)67-51(3)52(4)68(66-18-12-11-17-65(66)67)70(62-41-21-50(2)22-42-62)64-45-37-56(38-46-64)26-24-54-29-33-60(34-30-54)48-58-15-9-6-10-16-58/h11-12,17-48H,5-10,13-16H2,1-4H3/b25-23+,26-24+ |
| InChIKey | OSMGJNHHYYMAPY-OGGGYYITSA-N |
| XLogP | 20.05 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 911.29 |
| LogP ≤ 5 | 20.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|