About 5-isocyanato-1,3,3-trimethylcyclohexane-1-carbaldehyde
5-isocyanato-1,3,3-trimethylcyclohexane-1-carbaldehyde (PubChem CID 20731158) has the molecular formula C11H17NO2
and a molecular weight of 195.26 g/mol. Its IUPAC name is 5-isocyanato-1,3,3-trimethylcyclohexane-1-carbaldehyde.
Molecular Properties
| Compound Name | 5-isocyanato-1,3,3-trimethylcyclohexane-1-carbaldehyde |
| PubChem CID | 20731158 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 5-isocyanato-1,3,3-trimethylcyclohexane-1-carbaldehyde |
| SMILES | CC1(C)CC(N=C=O)CC(C)(C=O)C1 |
| InChI | InChI=1S/C11H17NO2/c1-10(2)4-9(12-8-14)5-11(3,6-10)7-13/h7,9H,4-6H2,1-3H3 |
| InChIKey | STOROIRSJSHCRM-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 5-isocyanato-1,3,3-trimethylcyclohexane-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-isocyanato-1,3,3-trimethylcyclohexane-1-carbaldehyde?
The IUPAC name of 5-isocyanato-1,3,3-trimethylcyclohexane-1-carbaldehyde (CID 20731158) is 5-isocyanato-1,3,3-trimethylcyclohexane-1-carbaldehyde.
What is the SMILES notation for 5-isocyanato-1,3,3-trimethylcyclohexane-1-carbaldehyde?
The canonical SMILES for 5-isocyanato-1,3,3-trimethylcyclohexane-1-carbaldehyde is CC1(C)CC(N=C=O)CC(C)(C=O)C1.
What is the InChIKey of 5-isocyanato-1,3,3-trimethylcyclohexane-1-carbaldehyde?
The InChIKey is STOROIRSJSHCRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO2/c1-10(2)4-9(12-8-14)5-11(3,6-10)7-13/h7,9H,4-6H2,1-3H3.
What are the key properties of 5-isocyanato-1,3,3-trimethylcyclohexane-1-carbaldehyde?
5-isocyanato-1,3,3-trimethylcyclohexane-1-carbaldehyde has a molecular weight of 195.26 g/mol, XLogP of 2.11, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-isocyanato-1,3,3-trimethylcyclohexane-1-carbaldehyde is sourced from PubChem (CID 20731158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).