About 6-(dimethylamino)-1'-ethylspiro[2-benzofuran-3,2'-benzo[cd]indole]-1-one
6-(dimethylamino)-1'-ethylspiro[2-benzofuran-3,2'-benzo[cd]indole]-1-one (PubChem CID 20731327) has the molecular formula C22H20N2O2
and a molecular weight of 344.41 g/mol. Its IUPAC name is 6-(dimethylamino)-1'-ethylspiro[2-benzofuran-3,2'-benzo[cd]indole]-1-one.
Molecular Properties
| Compound Name | 6-(dimethylamino)-1'-ethylspiro[2-benzofuran-3,2'-benzo[cd]indole]-1-one |
| PubChem CID | 20731327 |
| Molecular Formula | C22H20N2O2 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 6-(dimethylamino)-1'-ethylspiro[2-benzofuran-3,2'-benzo[cd]indole]-1-one |
| SMILES | CCN1c2cccc3cccc(c23)C12OC(=O)c1cc(N(C)C)ccc12 |
| InChI | InChI=1S/C22H20N2O2/c1-4-24-19-10-6-8-14-7-5-9-18(20(14)19)22(24)17-12-11-15(23(2)3)13-16(17)21(25)26-22/h5-13H,4H2,1-3H3 |
| InChIKey | IQZMPRIJFRXDJV-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|
Analyze 6-(dimethylamino)-1'-ethylspiro[2-benzofuran-3,2'-benzo[cd]indole]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(dimethylamino)-1'-ethylspiro[2-benzofuran-3,2'-benzo[cd]indole]-1-one?
The IUPAC name of 6-(dimethylamino)-1'-ethylspiro[2-benzofuran-3,2'-benzo[cd]indole]-1-one (CID 20731327) is 6-(dimethylamino)-1'-ethylspiro[2-benzofuran-3,2'-benzo[cd]indole]-1-one.
What is the SMILES notation for 6-(dimethylamino)-1'-ethylspiro[2-benzofuran-3,2'-benzo[cd]indole]-1-one?
The canonical SMILES for 6-(dimethylamino)-1'-ethylspiro[2-benzofuran-3,2'-benzo[cd]indole]-1-one is CCN1c2cccc3cccc(c23)C12OC(=O)c1cc(N(C)C)ccc12.
What is the InChIKey of 6-(dimethylamino)-1'-ethylspiro[2-benzofuran-3,2'-benzo[cd]indole]-1-one?
The InChIKey is IQZMPRIJFRXDJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20N2O2/c1-4-24-19-10-6-8-14-7-5-9-18(20(14)19)22(24)17-12-11-15(23(2)3)13-16(17)21(25)26-22/h5-13H,4H2,1-3H3.
What are the key properties of 6-(dimethylamino)-1'-ethylspiro[2-benzofuran-3,2'-benzo[cd]indole]-1-one?
6-(dimethylamino)-1'-ethylspiro[2-benzofuran-3,2'-benzo[cd]indole]-1-one has a molecular weight of 344.41 g/mol, XLogP of 4.12, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(dimethylamino)-1'-ethylspiro[2-benzofuran-3,2'-benzo[cd]indole]-1-one is sourced from PubChem (CID 20731327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).