About but-2-en-2-yldiazene
but-2-en-2-yldiazene (PubChem CID 20732290) has the molecular formula C4H8N2
and a molecular weight of 84.12 g/mol. Its IUPAC name is but-2-en-2-yldiazene.
Molecular Properties
| Compound Name | but-2-en-2-yldiazene |
| PubChem CID | 20732290 |
| Molecular Formula | C4H8N2 |
| Molecular Weight | 84.12 g/mol |
| Exact Mass | 84.07 |
| IUPAC Name | but-2-en-2-yldiazene |
| SMILES | [H]/N=N/C(C)=CC |
| InChI | InChI=1S/C4H8N2/c1-3-4(2)6-5/h3,5H,1-2H3/b4-3?,6-5+ |
| InChIKey | MREUBVAQQOZBLC-DSSYRYGXSA-N |
| XLogP | 1.94 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 84.12 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze but-2-en-2-yldiazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-2-en-2-yldiazene?
The IUPAC name of but-2-en-2-yldiazene (CID 20732290) is but-2-en-2-yldiazene.
What is the SMILES notation for but-2-en-2-yldiazene?
The canonical SMILES for but-2-en-2-yldiazene is [H]/N=N/C(C)=CC.
What is the InChIKey of but-2-en-2-yldiazene?
The InChIKey is MREUBVAQQOZBLC-DSSYRYGXSA-N. The full InChI is InChI=1S/C4H8N2/c1-3-4(2)6-5/h3,5H,1-2H3/b4-3?,6-5+.
What are the key properties of but-2-en-2-yldiazene?
but-2-en-2-yldiazene has a molecular weight of 84.12 g/mol, XLogP of 1.94, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for but-2-en-2-yldiazene is sourced from PubChem (CID 20732290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).