About 2-[[3,5-dichloro-4-[3-(3-chlorophenyl)-4-hydroxyphenoxy]-2-pyridinyl]amino]acetic acid
2-[[3,5-dichloro-4-[3-(3-chlorophenyl)-4-hydroxyphenoxy]-2-pyridinyl]amino]acetic acid (PubChem CID 20732338) has the molecular formula C19H13Cl3N2O4
and a molecular weight of 439.68 g/mol. Its IUPAC name is 2-[[3,5-dichloro-4-[3-(3-chlorophenyl)-4-hydroxyphenoxy]-2-pyridinyl]amino]acetic acid.
Molecular Properties
| Compound Name | 2-[[3,5-dichloro-4-[3-(3-chlorophenyl)-4-hydroxyphenoxy]-2-pyridinyl]amino]acetic acid |
| PubChem CID | 20732338 |
| Molecular Formula | C19H13Cl3N2O4 |
| Molecular Weight | 439.68 g/mol |
| Exact Mass | 437.99 |
| IUPAC Name | 2-[[3,5-dichloro-4-[3-(3-chlorophenyl)-4-hydroxyphenoxy]-2-pyridinyl]amino]acetic acid |
| SMILES | O=C(O)CNc1ncc(Cl)c(Oc2ccc(O)c(-c3cccc(Cl)c3)c2)c1Cl |
| InChI | InChI=1S/C19H13Cl3N2O4/c20-11-3-1-2-10(6-11)13-7-12(4-5-15(13)25)28-18-14(21)8-23-19(17(18)22)24-9-16(26)27/h1-8,25H,9H2,(H,23,24)(H,26,27) |
| InChIKey | VOSHTFSTXAYOFI-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 439.68 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[3,5-dichloro-4-[3-(3-chlorophenyl)-4-hydroxyphenoxy]-2-pyridinyl]amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3,5-dichloro-4-[3-(3-chlorophenyl)-4-hydroxyphenoxy]-2-pyridinyl]amino]acetic acid?
The IUPAC name of 2-[[3,5-dichloro-4-[3-(3-chlorophenyl)-4-hydroxyphenoxy]-2-pyridinyl]amino]acetic acid (CID 20732338) is 2-[[3,5-dichloro-4-[3-(3-chlorophenyl)-4-hydroxyphenoxy]-2-pyridinyl]amino]acetic acid.
What is the SMILES notation for 2-[[3,5-dichloro-4-[3-(3-chlorophenyl)-4-hydroxyphenoxy]-2-pyridinyl]amino]acetic acid?
The canonical SMILES for 2-[[3,5-dichloro-4-[3-(3-chlorophenyl)-4-hydroxyphenoxy]-2-pyridinyl]amino]acetic acid is O=C(O)CNc1ncc(Cl)c(Oc2ccc(O)c(-c3cccc(Cl)c3)c2)c1Cl.
What is the InChIKey of 2-[[3,5-dichloro-4-[3-(3-chlorophenyl)-4-hydroxyphenoxy]-2-pyridinyl]amino]acetic acid?
The InChIKey is VOSHTFSTXAYOFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13Cl3N2O4/c20-11-3-1-2-10(6-11)13-7-12(4-5-15(13)25)28-18-14(21)8-23-19(17(18)22)24-9-16(26)27/h1-8,25H,9H2,(H,23,24)(H,26,27).
What are the key properties of 2-[[3,5-dichloro-4-[3-(3-chlorophenyl)-4-hydroxyphenoxy]-2-pyridinyl]amino]acetic acid?
2-[[3,5-dichloro-4-[3-(3-chlorophenyl)-4-hydroxyphenoxy]-2-pyridinyl]amino]acetic acid has a molecular weight of 439.68 g/mol, XLogP of 5.70, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3,5-dichloro-4-[3-(3-chlorophenyl)-4-hydroxyphenoxy]-2-pyridinyl]amino]acetic acid is sourced from PubChem (CID 20732338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).