About 2-[[3,5-dichloro-6-methoxy-4-(4-methoxy-3-propan-2-ylphenoxy)-2-pyridinyl]amino]acetic acid
2-[[3,5-dichloro-6-methoxy-4-(4-methoxy-3-propan-2-ylphenoxy)-2-pyridinyl]amino]acetic acid (PubChem CID 20732348) has the molecular formula C18H20Cl2N2O5
and a molecular weight of 415.27 g/mol. Its IUPAC name is 2-[[3,5-dichloro-6-methoxy-4-(4-methoxy-3-propan-2-ylphenoxy)-2-pyridinyl]amino]acetic acid.
Molecular Properties
| Compound Name | 2-[[3,5-dichloro-6-methoxy-4-(4-methoxy-3-propan-2-ylphenoxy)-2-pyridinyl]amino]acetic acid |
| PubChem CID | 20732348 |
| Molecular Formula | C18H20Cl2N2O5 |
| Molecular Weight | 415.27 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | 2-[[3,5-dichloro-6-methoxy-4-(4-methoxy-3-propan-2-ylphenoxy)-2-pyridinyl]amino]acetic acid |
| SMILES | COc1ccc(Oc2c(Cl)c(NCC(=O)O)nc(OC)c2Cl)cc1C(C)C |
| InChI | InChI=1S/C18H20Cl2N2O5/c1-9(2)11-7-10(5-6-12(11)25-3)27-16-14(19)17(21-8-13(23)24)22-18(26-4)15(16)20/h5-7,9H,8H2,1-4H3,(H,21,22)(H,23,24) |
| InChIKey | UFMVLKUFEVUXRK-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 89.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.27 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[[3,5-dichloro-6-methoxy-4-(4-methoxy-3-propan-2-ylphenoxy)-2-pyridinyl]amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3,5-dichloro-6-methoxy-4-(4-methoxy-3-propan-2-ylphenoxy)-2-pyridinyl]amino]acetic acid?
The IUPAC name of 2-[[3,5-dichloro-6-methoxy-4-(4-methoxy-3-propan-2-ylphenoxy)-2-pyridinyl]amino]acetic acid (CID 20732348) is 2-[[3,5-dichloro-6-methoxy-4-(4-methoxy-3-propan-2-ylphenoxy)-2-pyridinyl]amino]acetic acid.
What is the SMILES notation for 2-[[3,5-dichloro-6-methoxy-4-(4-methoxy-3-propan-2-ylphenoxy)-2-pyridinyl]amino]acetic acid?
The canonical SMILES for 2-[[3,5-dichloro-6-methoxy-4-(4-methoxy-3-propan-2-ylphenoxy)-2-pyridinyl]amino]acetic acid is COc1ccc(Oc2c(Cl)c(NCC(=O)O)nc(OC)c2Cl)cc1C(C)C.
What is the InChIKey of 2-[[3,5-dichloro-6-methoxy-4-(4-methoxy-3-propan-2-ylphenoxy)-2-pyridinyl]amino]acetic acid?
The InChIKey is UFMVLKUFEVUXRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20Cl2N2O5/c1-9(2)11-7-10(5-6-12(11)25-3)27-16-14(19)17(21-8-13(23)24)22-18(26-4)15(16)20/h5-7,9H,8H2,1-4H3,(H,21,22)(H,23,24).
What are the key properties of 2-[[3,5-dichloro-6-methoxy-4-(4-methoxy-3-propan-2-ylphenoxy)-2-pyridinyl]amino]acetic acid?
2-[[3,5-dichloro-6-methoxy-4-(4-methoxy-3-propan-2-ylphenoxy)-2-pyridinyl]amino]acetic acid has a molecular weight of 415.27 g/mol, XLogP of 4.82, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3,5-dichloro-6-methoxy-4-(4-methoxy-3-propan-2-ylphenoxy)-2-pyridinyl]amino]acetic acid is sourced from PubChem (CID 20732348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).