About 2-amino-3-[[3,5-dichloro-6-fluoro-4-(4-hydroxy-3-propan-2-ylphenoxy)-2-pyridinyl]amino]propanoic acid
2-amino-3-[[3,5-dichloro-6-fluoro-4-(4-hydroxy-3-propan-2-ylphenoxy)-2-pyridinyl]amino]propanoic acid (PubChem CID 20732431) has the molecular formula C17H18Cl2FN3O4
and a molecular weight of 418.25 g/mol. Its IUPAC name is 2-amino-3-[[3,5-dichloro-6-fluoro-4-(4-hydroxy-3-propan-2-ylphenoxy)-2-pyridinyl]amino]propanoic acid.
Molecular Properties
| Compound Name | 2-amino-3-[[3,5-dichloro-6-fluoro-4-(4-hydroxy-3-propan-2-ylphenoxy)-2-pyridinyl]amino]propanoic acid |
| PubChem CID | 20732431 |
| Molecular Formula | C17H18Cl2FN3O4 |
| Molecular Weight | 418.25 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | 2-amino-3-[[3,5-dichloro-6-fluoro-4-(4-hydroxy-3-propan-2-ylphenoxy)-2-pyridinyl]amino]propanoic acid |
| SMILES | CC(C)c1cc(Oc2c(Cl)c(F)nc(NCC(N)C(=O)O)c2Cl)ccc1O |
| InChI | InChI=1S/C17H18Cl2FN3O4/c1-7(2)9-5-8(3-4-11(9)24)27-14-12(18)15(20)23-16(13(14)19)22-6-10(21)17(25)26/h3-5,7,10,24H,6,21H2,1-2H3,(H,22,23)(H,25,26) |
| InChIKey | XHXNICSTAUFXMN-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.25 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3-[[3,5-dichloro-6-fluoro-4-(4-hydroxy-3-propan-2-ylphenoxy)-2-pyridinyl]amino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-[[3,5-dichloro-6-fluoro-4-(4-hydroxy-3-propan-2-ylphenoxy)-2-pyridinyl]amino]propanoic acid?
The IUPAC name of 2-amino-3-[[3,5-dichloro-6-fluoro-4-(4-hydroxy-3-propan-2-ylphenoxy)-2-pyridinyl]amino]propanoic acid (CID 20732431) is 2-amino-3-[[3,5-dichloro-6-fluoro-4-(4-hydroxy-3-propan-2-ylphenoxy)-2-pyridinyl]amino]propanoic acid.
What is the SMILES notation for 2-amino-3-[[3,5-dichloro-6-fluoro-4-(4-hydroxy-3-propan-2-ylphenoxy)-2-pyridinyl]amino]propanoic acid?
The canonical SMILES for 2-amino-3-[[3,5-dichloro-6-fluoro-4-(4-hydroxy-3-propan-2-ylphenoxy)-2-pyridinyl]amino]propanoic acid is CC(C)c1cc(Oc2c(Cl)c(F)nc(NCC(N)C(=O)O)c2Cl)ccc1O.
What is the InChIKey of 2-amino-3-[[3,5-dichloro-6-fluoro-4-(4-hydroxy-3-propan-2-ylphenoxy)-2-pyridinyl]amino]propanoic acid?
The InChIKey is XHXNICSTAUFXMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18Cl2FN3O4/c1-7(2)9-5-8(3-4-11(9)24)27-14-12(18)15(20)23-16(13(14)19)22-6-10(21)17(25)26/h3-5,7,10,24H,6,21H2,1-2H3,(H,22,23)(H,25,26).
What are the key properties of 2-amino-3-[[3,5-dichloro-6-fluoro-4-(4-hydroxy-3-propan-2-ylphenoxy)-2-pyridinyl]amino]propanoic acid?
2-amino-3-[[3,5-dichloro-6-fluoro-4-(4-hydroxy-3-propan-2-ylphenoxy)-2-pyridinyl]amino]propanoic acid has a molecular weight of 418.25 g/mol, XLogP of 3.97, 7 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-[[3,5-dichloro-6-fluoro-4-(4-hydroxy-3-propan-2-ylphenoxy)-2-pyridinyl]amino]propanoic acid is sourced from PubChem (CID 20732431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).