C19H21Cl2FN2O4 — CID 20732449
4-[[3,5-dichloro-2-[2-(1,3-dioxolan-2-yl)ethylamino]-6-fluoro-4-pyridinyl]oxy]-2-propan-2-ylphenol (PubChem CID 20732449) has the molecular formula C19H21Cl2FN2O4 and a molecular weight of 431.29 g/mol. Its IUPAC name is 4-[[3,5-dichloro-2-[2-(1,3-dioxolan-2-yl)ethylamino]-6-fluoro-4-pyridinyl]oxy]-2-propan-2-ylphenol.
| Compound Name | 4-[[3,5-dichloro-2-[2-(1,3-dioxolan-2-yl)ethylamino]-6-fluoro-4-pyridinyl]oxy]-2-propan-2-ylphenol |
|---|---|
| PubChem CID | 20732449 |
| Molecular Formula | C19H21Cl2FN2O4 |
| Molecular Weight | 431.29 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 4-[[3,5-dichloro-2-[2-(1,3-dioxolan-2-yl)ethylamino]-6-fluoro-4-pyridinyl]oxy]-2-propan-2-ylphenol |
| SMILES | CC(C)c1cc(Oc2c(Cl)c(F)nc(NCCC3OCCO3)c2Cl)ccc1O |
| InChI | InChI=1S/C19H21Cl2FN2O4/c1-10(2)12-9-11(3-4-13(12)25)28-17-15(20)18(22)24-19(16(17)21)23-6-5-14-26-7-8-27-14/h3-4,9-10,14,25H,5-8H2,1-2H3,(H,23,24) |
| InChIKey | XMGQUMVUZUHZPP-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 72.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.29 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|