C11H18N2O2S2 — CID 20732710
(4,4-dimethyl-5-oxo-1,3-oxazol-2-yl)methyl N,N-diethylcarbamodithioate (PubChem CID 20732710) has the molecular formula C11H18N2O2S2 and a molecular weight of 274.41 g/mol. Its IUPAC name is (4,4-dimethyl-5-oxo-1,3-oxazol-2-yl)methyl N,N-diethylcarbamodithioate.
| Compound Name | (4,4-dimethyl-5-oxo-1,3-oxazol-2-yl)methyl N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 20732710 |
| Molecular Formula | C11H18N2O2S2 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | (4,4-dimethyl-5-oxo-1,3-oxazol-2-yl)methyl N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)SCC1=NC(C)(C)C(=O)O1 |
| InChI | InChI=1S/C11H18N2O2S2/c1-5-13(6-2)10(16)17-7-8-12-11(3,4)9(14)15-8/h5-7H2,1-4H3 |
| InChIKey | HSGKLEZPMGNCLZ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|