About [2,4,5-tris(ethanethioylsulfanylmethyl)phenyl]methyl ethanedithioate
[2,4,5-tris(ethanethioylsulfanylmethyl)phenyl]methyl ethanedithioate (PubChem CID 20732719) has the molecular formula C18H22S8
and a molecular weight of 494.91 g/mol. Its IUPAC name is [2,4,5-tris(ethanethioylsulfanylmethyl)phenyl]methyl ethanedithioate.
Molecular Properties
| Compound Name | [2,4,5-tris(ethanethioylsulfanylmethyl)phenyl]methyl ethanedithioate |
| PubChem CID | 20732719 |
| Molecular Formula | C18H22S8 |
| Molecular Weight | 494.91 g/mol |
| Exact Mass | 493.95 |
| IUPAC Name | [2,4,5-tris(ethanethioylsulfanylmethyl)phenyl]methyl ethanedithioate |
| SMILES | CC(=S)SCc1cc(CSC(C)=S)c(CSC(C)=S)cc1CSC(C)=S |
| InChI | InChI=1S/C18H22S8/c1-11(19)23-7-15-5-17(9-25-13(3)21)18(10-26-14(4)22)6-16(15)8-24-12(2)20/h5-6H,7-10H2,1-4H3 |
| InChIKey | PHVYRQYWOXZVFC-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 494.91 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [2,4,5-tris(ethanethioylsulfanylmethyl)phenyl]methyl ethanedithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,4,5-tris(ethanethioylsulfanylmethyl)phenyl]methyl ethanedithioate?
The IUPAC name of [2,4,5-tris(ethanethioylsulfanylmethyl)phenyl]methyl ethanedithioate (CID 20732719) is [2,4,5-tris(ethanethioylsulfanylmethyl)phenyl]methyl ethanedithioate.
What is the SMILES notation for [2,4,5-tris(ethanethioylsulfanylmethyl)phenyl]methyl ethanedithioate?
The canonical SMILES for [2,4,5-tris(ethanethioylsulfanylmethyl)phenyl]methyl ethanedithioate is CC(=S)SCc1cc(CSC(C)=S)c(CSC(C)=S)cc1CSC(C)=S.
What is the InChIKey of [2,4,5-tris(ethanethioylsulfanylmethyl)phenyl]methyl ethanedithioate?
The InChIKey is PHVYRQYWOXZVFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22S8/c1-11(19)23-7-15-5-17(9-25-13(3)21)18(10-26-14(4)22)6-16(15)8-24-12(2)20/h5-6H,7-10H2,1-4H3.
What are the key properties of [2,4,5-tris(ethanethioylsulfanylmethyl)phenyl]methyl ethanedithioate?
[2,4,5-tris(ethanethioylsulfanylmethyl)phenyl]methyl ethanedithioate has a molecular weight of 494.91 g/mol, XLogP of 8.01, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [2,4,5-tris(ethanethioylsulfanylmethyl)phenyl]methyl ethanedithioate is sourced from PubChem (CID 20732719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).