C24H43N11O4P- — CID 20732767
[5-[(1-amino-1-oxobutan-2-yl)amino]-4-[[2-[(3-amino-1H-1,2,4-triazole-5-carbonyl)amino]-3-cyclohexylpropanoyl]amino]-5-oxopentyl]-[(Z)-N'-dimethylphosphanylcarbamimidoyl]azanide (PubChem CID 20732767) has the molecular formula C24H43N11O4P- and a molecular weight of 580.66 g/mol. Its IUPAC name is [5-[(1-amino-1-oxobutan-2-yl)amino]-4-[[2-[(3-amino-1H-1,2,4-triazole-5-carbonyl)amino]-3-cyclohexylpropanoyl]amino]-5-oxopentyl]-[(Z)-N'-dimethylphosphanylcarbamimidoyl]azanide.
| Compound Name | [5-[(1-amino-1-oxobutan-2-yl)amino]-4-[[2-[(3-amino-1H-1,2,4-triazole-5-carbonyl)amino]-3-cyclohexylpropanoyl]amino]-5-oxopentyl]-[(Z)-N'-dimethylphosphanylcarbamimidoyl]azanide |
|---|---|
| PubChem CID | 20732767 |
| Molecular Formula | C24H43N11O4P- |
| Molecular Weight | 580.66 g/mol |
| Exact Mass | 580.32 |
| IUPAC Name | [5-[(1-amino-1-oxobutan-2-yl)amino]-4-[[2-[(3-amino-1H-1,2,4-triazole-5-carbonyl)amino]-3-cyclohexylpropanoyl]amino]-5-oxopentyl]-[(Z)-N'-dimethylphosphanylcarbamimidoyl]azanide |
| SMILES | CCC(NC(=O)C(CCC[N-]/C(N)=N\P(C)C)NC(=O)C(CC1CCCCC1)NC(=O)c1nc(N)n[nH]1)C(N)=O |
| InChI | InChI=1S/C24H44N11O4P/c1-4-15(18(25)36)29-20(37)16(11-8-12-28-23(26)35-40(2)3)30-21(38)17(13-14-9-6-5-7-10-14)31-22(39)19-32-24(27)34-33-19/h14-17H,4-13H2,1-3H3,(H11,25,26,27,28,29,30,31,32,33,34,35,36,37,38,39)/p-1 |
| InChIKey | DEKCQRYWCFEMNU-UHFFFAOYSA-M |
| XLogP | 0.45 |
| TPSA | 250.46 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.66 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|