About 2,3-dimethyl-9H-fluorene
2,3-dimethyl-9H-fluorene (PubChem CID 20734) has the molecular formula C15H14
and a molecular weight of 194.28 g/mol. Its IUPAC name is 2,3-dimethyl-9H-fluorene.
Molecular Properties
| Compound Name | 2,3-dimethyl-9H-fluorene |
| PubChem CID | 20734 |
| Molecular Formula | C15H14 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 2,3-dimethyl-9H-fluorene |
| SMILES | Cc1cc2c(cc1C)-c1ccccc1C2 |
| InChI | InChI=1S/C15H14/c1-10-7-13-9-12-5-3-4-6-14(12)15(13)8-11(10)2/h3-8H,9H2,1-2H3 |
| InChIKey | WZKBKKCKPZMGHV-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2,3-dimethyl-9H-fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-9H-fluorene?
The IUPAC name of 2,3-dimethyl-9H-fluorene (CID 20734) is 2,3-dimethyl-9H-fluorene.
What is the SMILES notation for 2,3-dimethyl-9H-fluorene?
The canonical SMILES for 2,3-dimethyl-9H-fluorene is Cc1cc2c(cc1C)-c1ccccc1C2.
What is the InChIKey of 2,3-dimethyl-9H-fluorene?
The InChIKey is WZKBKKCKPZMGHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14/c1-10-7-13-9-12-5-3-4-6-14(12)15(13)8-11(10)2/h3-8H,9H2,1-2H3.
What are the key properties of 2,3-dimethyl-9H-fluorene?
2,3-dimethyl-9H-fluorene has a molecular weight of 194.28 g/mol, XLogP of 3.87, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-9H-fluorene is sourced from PubChem (CID 20734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).